nonanedioic acid


azelaic acid; nonanedioic acid
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Org. Chem., v. Richter, 1. Vol (Azelaic Acid); p. 300, 506,
MeSH:Antineoplastic Agents
CAS RN:[123-99-9]
Formula:C9H16O4; 188.22 g/mol
InChiKey:BDJRBEYXGGNYIS-UHFFFAOYSA-N
SMILES:OC(=O)CCCCCCCC(O)=O
Molecular structure of nonanedioic acid
Density:1.029 g/mL
Molar volume:182.9 mL/mol
Refractive index:1.428
Molecular refractive power:47.06 mL/mol
Dipole moment:2.35 D
Melting point:106 °C
Boiling point:357 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:2.7 atm
Log10 partition octanol / water:1.57
1g dissolves in:
450.45g water

Isomers

butyl 2-acetyloxypropanoate
Molecular structure of butyl 2-acetyloxypropanoate
tert-butyl ethyl malonate
Molecular structure of tert-butyl ethyl malonate
1,5-diacetoxypentane
Molecular structure of 1,5-diacetoxypentane
diethyl 2,2-dimethylpropanedioate
Molecular structure of diethyl 2,2-dimethylpropanedioate
di(ethylene glycol) ethyl ether acrylate
Molecular structure of di(ethylene glycol) ethyl ether acrylate
di(ethylene glycol) methyl ether methacrylate
Molecular structure of di(ethylene glycol) methyl ether methacrylate
diethyl 2-ethylpropanedioate
Molecular structure of diethyl 2-ethylpropanedioate
3,3-diethylglutaric acid
Molecular structure of 3,3-diethylglutaric acid
diethyl 2-methylbutanedioate
Molecular structure of diethyl 2-methylbutanedioate
diethyl pentanedioate
Molecular structure of diethyl pentanedioate
diisopropyl malonate
Molecular structure of diisopropyl malonate
dimethyl tert-butylmalonate
Molecular structure of dimethyl tert-butylmalonate
dimethyl 3,3-dimethylpentanedioate
Molecular structure of dimethyl 3,3-dimethylpentanedioate
dimethyl heptanedioate
Molecular structure of dimethyl heptanedioate
dimethyl isobutylmalonate
Molecular structure of dimethyl isobutylmalonate
dimethyl 2-methyladipate
Molecular structure of dimethyl 2-methyladipate
dimethyl 2,2-pentanedicarboxylate
Molecular structure of dimethyl 2,2-pentanedicarboxylate
dimethyl 3,3-pentanedicarboxylate
Molecular structure of dimethyl 3,3-pentanedicarboxylate
dipropyl propanedioate
Molecular structure of dipropyl propanedioate
2,2-dipropylpropanonic acid
Molecular structure of 2,2-dipropylpropanonic acid
ethyl 2-(2,4-dimethyl-1,3-dioxolan-2-yl)acetate
Molecular structure of ethyl 2-(2,4-dimethyl-1,3-dioxolan-2-yl)acetate
ethyl hydrogen heptanedioate
Molecular structure of ethyl hydrogen heptanedioate
hexylpropanedioic acid
Molecular structure of hexylpropanedioic acid
methyl hydrogen suberate
Molecular structure of methyl hydrogen suberate
3-methyl-3-propylpentanedioic acid
Molecular structure of 3-methyl-3-propylpentanedioic acid
nonanedioic acid
Molecular structure of nonanedioic acid
2,2'-trimethylenebis-1,3-dioxolane
Molecular structure of 2,2'-trimethylenebis-1,3-dioxolane
2,3,3-trimethylhexanedioic acid
Molecular structure of 2,3,3-trimethylhexanedioic acid